C9H7BrF3NO3 — CID 175168242
[3-bromo-5-(trifluoromethoxy)phenyl]methyl carbamate (PubChem CID 175168242) has the molecular formula C9H7BrF3NO3 and a molecular weight of 314.06 g/mol. Its IUPAC name is [3-bromo-5-(trifluoromethoxy)phenyl]methyl carbamate.
| Compound Name | [3-bromo-5-(trifluoromethoxy)phenyl]methyl carbamate |
|---|---|
| PubChem CID | 175168242 |
| Molecular Formula | C9H7BrF3NO3 |
| Molecular Weight | 314.06 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | [3-bromo-5-(trifluoromethoxy)phenyl]methyl carbamate |
| SMILES | NC(=O)OCc1cc(Br)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C9H7BrF3NO3/c10-6-1-5(4-16-8(14)15)2-7(3-6)17-9(11,12)13/h1-3H,4H2,(H2,14,15) |
| InChIKey | CPARCASRUXYYPP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.06 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |