C24H28F2O4 — CID 91740368
4-O-[(3,4-difluorophenyl)methyl] 1-O-nonyl benzene-1,4-dicarboxylate (PubChem CID 91740368) has the molecular formula C24H28F2O4 and a molecular weight of 418.48 g/mol. Its IUPAC name is 4-O-[(3,4-difluorophenyl)methyl] 1-O-nonyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[(3,4-difluorophenyl)methyl] 1-O-nonyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91740368 |
| Molecular Formula | C24H28F2O4 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-O-[(3,4-difluorophenyl)methyl] 1-O-nonyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)c1ccc(C(=O)OCc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C24H28F2O4/c1-2-3-4-5-6-7-8-15-29-23(27)19-10-12-20(13-11-19)24(28)30-17-18-9-14-21(25)22(26)16-18/h9-14,16H,2-8,15,17H2,1H3 |
| InChIKey | LZIADGCCFRIFIJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|