C22H25FO4 — CID 91738345
4-O-[(3-fluorophenyl)methyl] 1-O-heptyl benzene-1,4-dicarboxylate (PubChem CID 91738345) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is 4-O-[(3-fluorophenyl)methyl] 1-O-heptyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[(3-fluorophenyl)methyl] 1-O-heptyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91738345 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-O-[(3-fluorophenyl)methyl] 1-O-heptyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1ccc(C(=O)OCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H25FO4/c1-2-3-4-5-6-14-26-21(24)18-10-12-19(13-11-18)22(25)27-16-17-8-7-9-20(23)15-17/h7-13,15H,2-6,14,16H2,1H3 |
| InChIKey | UOEHXRSCYZICEC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|