C31H25ClO6 — CID 67248535
[3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenyl] 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate (PubChem CID 67248535) has the molecular formula C31H25ClO6 and a molecular weight of 528.99 g/mol. Its IUPAC name is [3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenyl] 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate.
| Compound Name | [3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenyl] 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 67248535 |
| Molecular Formula | C31H25ClO6 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | [3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenyl] 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)Oc1cc(O)cc(C=Cc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C31H25ClO6/c1-31(2,38-27-15-9-23(10-16-27)29(35)22-7-11-24(32)12-8-22)30(36)37-28-18-21(17-26(34)19-28)4-3-20-5-13-25(33)14-6-20/h3-19,33-34H,1-2H3 |
| InChIKey | UOYBCZOZJKGEDZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|