C32H34O3S — CID 129089574
1-tert-butyl-4-[4-[4-[4-[(2-methylpropan-2-yl)oxy]phenoxy]phenoxy]phenyl]sulfanylbenzene (PubChem CID 129089574) has the molecular formula C32H34O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is 1-tert-butyl-4-[4-[4-[4-[(2-methylpropan-2-yl)oxy]phenoxy]phenoxy]phenyl]sulfanylbenzene.
| Compound Name | 1-tert-butyl-4-[4-[4-[4-[(2-methylpropan-2-yl)oxy]phenoxy]phenoxy]phenyl]sulfanylbenzene |
|---|---|
| PubChem CID | 129089574 |
| Molecular Formula | C32H34O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 1-tert-butyl-4-[4-[4-[4-[(2-methylpropan-2-yl)oxy]phenoxy]phenoxy]phenyl]sulfanylbenzene |
| SMILES | CC(C)(C)Oc1ccc(Oc2ccc(Oc3ccc(Sc4ccc(C(C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H34O3S/c1-31(2,3)23-7-19-29(20-8-23)36-30-21-17-27(18-22-30)34-25-11-9-24(10-12-25)33-26-13-15-28(16-14-26)35-32(4,5)6/h7-22H,1-6H3 |
| InChIKey | ZXPCBOLEZLZTLW-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |