C20H26OS — CID 129163721
1-tert-butyl-4-(4-tert-butylsulfanylphenoxy)benzene (PubChem CID 129163721) has the molecular formula C20H26OS and a molecular weight of 314.49 g/mol. Its IUPAC name is 1-tert-butyl-4-(4-tert-butylsulfanylphenoxy)benzene.
| Compound Name | 1-tert-butyl-4-(4-tert-butylsulfanylphenoxy)benzene |
|---|---|
| PubChem CID | 129163721 |
| Molecular Formula | C20H26OS |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-tert-butyl-4-(4-tert-butylsulfanylphenoxy)benzene |
| SMILES | CC(C)(C)Sc1ccc(Oc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H26OS/c1-19(2,3)15-7-9-16(10-8-15)21-17-11-13-18(14-12-17)22-20(4,5)6/h7-14H,1-6H3 |
| InChIKey | FSPRRRYTXXPADJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |