C25H28OS — CID 167298783
1-(4-tert-butylphenyl)sulfanyl-4-(4-propan-2-ylphenoxy)benzene (PubChem CID 167298783) has the molecular formula C25H28OS and a molecular weight of 376.57 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfanyl-4-(4-propan-2-ylphenoxy)benzene.
| Compound Name | 1-(4-tert-butylphenyl)sulfanyl-4-(4-propan-2-ylphenoxy)benzene |
|---|---|
| PubChem CID | 167298783 |
| Molecular Formula | C25H28OS |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfanyl-4-(4-propan-2-ylphenoxy)benzene |
| SMILES | CC(C)c1ccc(Oc2ccc(Sc3ccc(C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H28OS/c1-18(2)19-6-10-21(11-7-19)26-22-12-16-24(17-13-22)27-23-14-8-20(9-15-23)25(3,4)5/h6-18H,1-5H3 |
| InChIKey | IJBFJZYADNYUBO-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |