C29H42O3 — CID 138660253
[4-[2-methyl-1-[4-(2-methylbutan-2-yloxy)phenyl]propyl]phenyl] 2-ethyl-2-methylpentanoate (PubChem CID 138660253) has the molecular formula C29H42O3 and a molecular weight of 438.65 g/mol. Its IUPAC name is [4-[2-methyl-1-[4-(2-methylbutan-2-yloxy)phenyl]propyl]phenyl] 2-ethyl-2-methylpentanoate.
| Compound Name | [4-[2-methyl-1-[4-(2-methylbutan-2-yloxy)phenyl]propyl]phenyl] 2-ethyl-2-methylpentanoate |
|---|---|
| PubChem CID | 138660253 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | [4-[2-methyl-1-[4-(2-methylbutan-2-yloxy)phenyl]propyl]phenyl] 2-ethyl-2-methylpentanoate |
| SMILES | CCCC(C)(CC)C(=O)Oc1ccc(C(c2ccc(OC(C)(C)CC)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C29H42O3/c1-9-20-29(8,11-3)27(30)31-24-16-12-22(13-17-24)26(21(4)5)23-14-18-25(19-15-23)32-28(6,7)10-2/h12-19,21,26H,9-11,20H2,1-8H3 |
| InChIKey | YDCYKFPMHIRMGZ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|