C19H30O — CID 173467970
1-[(Z)-2,2-dimethylhex-4-en-3-yl]-4-(2-methylbutan-2-yloxy)benzene (PubChem CID 173467970) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-[(Z)-2,2-dimethylhex-4-en-3-yl]-4-(2-methylbutan-2-yloxy)benzene.
| Compound Name | 1-[(Z)-2,2-dimethylhex-4-en-3-yl]-4-(2-methylbutan-2-yloxy)benzene |
|---|---|
| PubChem CID | 173467970 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 1-[(Z)-2,2-dimethylhex-4-en-3-yl]-4-(2-methylbutan-2-yloxy)benzene |
| SMILES | C/C=C\C(c1ccc(OC(C)(C)CC)cc1)C(C)(C)C |
| InChI | InChI=1S/C19H30O/c1-8-10-17(18(3,4)5)15-11-13-16(14-12-15)20-19(6,7)9-2/h8,10-14,17H,9H2,1-7H3/b10-8- |
| InChIKey | ZYJBCRDHNORYAW-NTMALXAHSA-N |
| XLogP | 5.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|