C20H36O4 — CID 159228016
1,4-bis(methoxymethyl)benzene;2,5-dimethoxy-2,5-dimethylhexane (PubChem CID 159228016) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 1,4-bis(methoxymethyl)benzene;2,5-dimethoxy-2,5-dimethylhexane.
| Compound Name | 1,4-bis(methoxymethyl)benzene;2,5-dimethoxy-2,5-dimethylhexane |
|---|---|
| PubChem CID | 159228016 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 1,4-bis(methoxymethyl)benzene;2,5-dimethoxy-2,5-dimethylhexane |
| SMILES | COC(C)(C)CCC(C)(C)OC.COCc1ccc(COC)cc1 |
| InChI | InChI=1S/C10H14O2.C10H22O2/c1-11-7-9-3-5-10(6-4-9)8-12-2;1-9(2,11-5)7-8-10(3,4)12-6/h3-6H,7-8H2,1-2H3;7-8H2,1-6H3 |
| InChIKey | KSNPCUNOVNXTBV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |