C12H12BrF3O — CID 115515755
1-(4-bromophenyl)-6,6,6-trifluorohexan-2-one (PubChem CID 115515755) has the molecular formula C12H12BrF3O and a molecular weight of 309.12 g/mol. Its IUPAC name is 1-(4-bromophenyl)-6,6,6-trifluorohexan-2-one.
| Compound Name | 1-(4-bromophenyl)-6,6,6-trifluorohexan-2-one |
|---|---|
| PubChem CID | 115515755 |
| Molecular Formula | C12H12BrF3O |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 1-(4-bromophenyl)-6,6,6-trifluorohexan-2-one |
| SMILES | O=C(CCCC(F)(F)F)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H12BrF3O/c13-10-5-3-9(4-6-10)8-11(17)2-1-7-12(14,15)16/h3-6H,1-2,7-8H2 |
| InChIKey | KHWRRKWKRZRCOS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |