C12H12F4O — CID 115515783
6,6,6-trifluoro-1-(3-fluorophenyl)hexan-2-one (PubChem CID 115515783) has the molecular formula C12H12F4O and a molecular weight of 248.22 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-(3-fluorophenyl)hexan-2-one.
| Compound Name | 6,6,6-trifluoro-1-(3-fluorophenyl)hexan-2-one |
|---|---|
| PubChem CID | 115515783 |
| Molecular Formula | C12H12F4O |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 6,6,6-trifluoro-1-(3-fluorophenyl)hexan-2-one |
| SMILES | O=C(CCCC(F)(F)F)Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H12F4O/c13-10-4-1-3-9(7-10)8-11(17)5-2-6-12(14,15)16/h1,3-4,7H,2,5-6,8H2 |
| InChIKey | LACYGWBTJSHWJR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |