C9H6BrClF2O — CID 112574585
3-(4-bromophenyl)-1-chloro-1,1-difluoropropan-2-one (PubChem CID 112574585) has the molecular formula C9H6BrClF2O and a molecular weight of 283.50 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-chloro-1,1-difluoropropan-2-one.
| Compound Name | 3-(4-bromophenyl)-1-chloro-1,1-difluoropropan-2-one |
|---|---|
| PubChem CID | 112574585 |
| Molecular Formula | C9H6BrClF2O |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | 3-(4-bromophenyl)-1-chloro-1,1-difluoropropan-2-one |
| SMILES | O=C(Cc1ccc(Br)cc1)C(F)(F)Cl |
| InChI | InChI=1S/C9H6BrClF2O/c10-7-3-1-6(2-4-7)5-8(14)9(11,12)13/h1-4H,5H2 |
| InChIKey | QEGJKXQQAGJVSV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|