C10H8Cl2F2O — CID 106867096
1-chloro-3-(2-chloro-4-methylphenyl)-1,1-difluoropropan-2-one (PubChem CID 106867096) has the molecular formula C10H8Cl2F2O and a molecular weight of 253.07 g/mol. Its IUPAC name is 1-chloro-3-(2-chloro-4-methylphenyl)-1,1-difluoropropan-2-one.
| Compound Name | 1-chloro-3-(2-chloro-4-methylphenyl)-1,1-difluoropropan-2-one |
|---|---|
| PubChem CID | 106867096 |
| Molecular Formula | C10H8Cl2F2O |
| Molecular Weight | 253.07 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 1-chloro-3-(2-chloro-4-methylphenyl)-1,1-difluoropropan-2-one |
| SMILES | Cc1ccc(CC(=O)C(F)(F)Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2F2O/c1-6-2-3-7(8(11)4-6)5-9(15)10(12,13)14/h2-4H,5H2,1H3 |
| InChIKey | MITYONJLBXJUOF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.07 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|