C9H6Cl2F2O — CID 130136780
2-chloro-1-(2-chloro-5-methylphenyl)-2,2-difluoroethanone (PubChem CID 130136780) has the molecular formula C9H6Cl2F2O and a molecular weight of 239.05 g/mol. Its IUPAC name is 2-chloro-1-(2-chloro-5-methylphenyl)-2,2-difluoroethanone.
| Compound Name | 2-chloro-1-(2-chloro-5-methylphenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 130136780 |
| Molecular Formula | C9H6Cl2F2O |
| Molecular Weight | 239.05 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 2-chloro-1-(2-chloro-5-methylphenyl)-2,2-difluoroethanone |
| SMILES | Cc1ccc(Cl)c(C(=O)C(F)(F)Cl)c1 |
| InChI | InChI=1S/C9H6Cl2F2O/c1-5-2-3-7(10)6(4-5)8(14)9(11,12)13/h2-4H,1H3 |
| InChIKey | WOZGSEOZZDVMKL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.05 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|