C20H16Br2O2 — CID 71405314
1,8-bis(4-bromophenyl)octa-3,5-diene-2,7-dione (PubChem CID 71405314) has the molecular formula C20H16Br2O2 and a molecular weight of 448.15 g/mol. Its IUPAC name is 1,8-bis(4-bromophenyl)octa-3,5-diene-2,7-dione.
| Compound Name | 1,8-bis(4-bromophenyl)octa-3,5-diene-2,7-dione |
|---|---|
| PubChem CID | 71405314 |
| Molecular Formula | C20H16Br2O2 |
| Molecular Weight | 448.15 g/mol |
| Exact Mass | 445.95 |
| IUPAC Name | 1,8-bis(4-bromophenyl)octa-3,5-diene-2,7-dione |
| SMILES | O=C(C=CC=CC(=O)Cc1ccc(Br)cc1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16Br2O2/c21-17-9-5-15(6-10-17)13-19(23)3-1-2-4-20(24)14-16-7-11-18(22)12-8-16/h1-12H,13-14H2 |
| InChIKey | VANXURDNCIWBNP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.15 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|