C5H11NO2S — CID 135373086
2-amino-4-methylsulfanylbutanoate;hydron (PubChem CID 135373086) has the molecular formula C5H11NO2S and a molecular weight of 149.22 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoate;hydron.
| Compound Name | 2-amino-4-methylsulfanylbutanoate;hydron |
|---|---|
| PubChem CID | 135373086 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoate;hydron |
| SMILES | CSCCC(N)C(=O)[O-].[H+] |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | FFEARJCKVFRZRR-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |