C10H20CuN2O4S2-2 — CID 172908207
CID 172908207 (PubChem CID 172908207) has the molecular formula C10H20CuN2O4S2-2 and a molecular weight of 359.96 g/mol.
| Compound Name | CID 172908207 |
|---|---|
| PubChem CID | 172908207 |
| Molecular Formula | C10H20CuN2O4S2-2 |
| Molecular Weight | 359.96 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | — |
| SMILES | CSCC[C@H](N)C(=O)[O-].CSCC[C@H](N)C(=O)[O-].[Cu] |
| InChI | InChI=1S/2C5H11NO2S.Cu/c2*1-9-3-2-4(6)5(7)8;/h2*4H,2-3,6H2,1H3,(H,7,8);/p-2/t2*4-;/m00./s1 |
| InChIKey | PBRVAIFGUWYHBF-SCGRZTRASA-L |
| XLogP | -2.37 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.96 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |