C7H12Cl3NO4S — CID 139065702
[(1S)-1-carboxy-3-methylsulfanylpropyl]azanium;2,2,2-trichloroacetate (PubChem CID 139065702) has the molecular formula C7H12Cl3NO4S and a molecular weight of 312.60 g/mol. Its IUPAC name is [(1S)-1-carboxy-3-methylsulfanylpropyl]azanium;2,2,2-trichloroacetate.
| Compound Name | [(1S)-1-carboxy-3-methylsulfanylpropyl]azanium;2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 139065702 |
| Molecular Formula | C7H12Cl3NO4S |
| Molecular Weight | 312.60 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | [(1S)-1-carboxy-3-methylsulfanylpropyl]azanium;2,2,2-trichloroacetate |
| SMILES | CSCC[C@H]([NH3+])C(=O)O.O=C([O-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H11NO2S.C2HCl3O2/c1-9-3-2-4(6)5(7)8;3-2(4,5)1(6)7/h4H,2-3,6H2,1H3,(H,7,8);(H,6,7)/t4-;/m0./s1 |
| InChIKey | RZHGJXYUDLQGQB-WCCKRBBISA-N |
| XLogP | -0.46 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.60 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|