C18H42Cl2N6 — CID 135665642
diaminomethylidene-[16-(diaminomethylideneazaniumyl)hexadecyl]azanium dichloride (PubChem CID 135665642) has the molecular formula C18H42Cl2N6 and a molecular weight of 413.48 g/mol. Its IUPAC name is diaminomethylidene-[16-(diaminomethylideneazaniumyl)hexadecyl]azanium dichloride.
| Compound Name | diaminomethylidene-[16-(diaminomethylideneazaniumyl)hexadecyl]azanium dichloride |
|---|---|
| PubChem CID | 135665642 |
| Molecular Formula | C18H42Cl2N6 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | diaminomethylidene-[16-(diaminomethylideneazaniumyl)hexadecyl]azanium dichloride |
| SMILES | NC(N)=[NH+]CCCCCCCCCCCCCCCC[NH+]=C(N)N.[Cl-].[Cl-] |
| InChI | InChI=1S/C18H40N6.2ClH/c19-17(20)23-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-24-18(21)22;;/h1-16H2,(H4,19,20,23)(H4,21,22,24);2*1H |
| InChIKey | UPYYHCSJGOXTJI-UHFFFAOYSA-N |
| XLogP | -6.84 |
| TPSA | 132.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | -6.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|