C8H17ClN4O — CID 140849995
diaminomethylidene-[3-(2-methylprop-2-enoylamino)propyl]azanium chloride (PubChem CID 140849995) has the molecular formula C8H17ClN4O and a molecular weight of 220.70 g/mol. Its IUPAC name is diaminomethylidene-[3-(2-methylprop-2-enoylamino)propyl]azanium chloride.
| Compound Name | diaminomethylidene-[3-(2-methylprop-2-enoylamino)propyl]azanium chloride |
|---|---|
| PubChem CID | 140849995 |
| Molecular Formula | C8H17ClN4O |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | diaminomethylidene-[3-(2-methylprop-2-enoylamino)propyl]azanium chloride |
| SMILES | C=C(C)C(=O)NCCC[NH+]=C(N)N.[Cl-] |
| InChI | InChI=1S/C8H16N4O.ClH/c1-6(2)7(13)11-4-3-5-12-8(9)10;/h1,3-5H2,2H3,(H,11,13)(H4,9,10,12);1H |
| InChIKey | PUUNVKFUGNVKMX-UHFFFAOYSA-N |
| XLogP | -5.57 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | -5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|