C7H14NO4+ — CID 6994978
[(2S)-1,5-dimethoxy-1,5-dioxopentan-2-yl]azanium (PubChem CID 6994978) has the molecular formula C7H14NO4+ and a molecular weight of 176.19 g/mol. Its IUPAC name is [(2S)-1,5-dimethoxy-1,5-dioxopentan-2-yl]azanium.
| Compound Name | [(2S)-1,5-dimethoxy-1,5-dioxopentan-2-yl]azanium |
|---|---|
| PubChem CID | 6994978 |
| Molecular Formula | C7H14NO4+ |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | [(2S)-1,5-dimethoxy-1,5-dioxopentan-2-yl]azanium |
| SMILES | COC(=O)CC[C@H]([NH3+])C(=O)OC |
| InChI | InChI=1S/C7H13NO4/c1-11-6(9)4-3-5(8)7(10)12-2/h5H,3-4,8H2,1-2H3/p+1/t5-/m0/s1 |
| InChIKey | YEJSPQZHMWGIGP-YFKPBYRVSA-O |
| XLogP | -1.28 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |