C8H18Cl2N2O4S2 — CID 11089122
[(2R)-3-[[(2R)-2-azaniumyl-3-methoxy-3-oxopropyl]disulfanyl]-1-methoxy-1-oxopropan-2-yl]azanium dichloride (PubChem CID 11089122) has the molecular formula C8H18Cl2N2O4S2 and a molecular weight of 341.28 g/mol. Its IUPAC name is [(2R)-3-[[(2R)-2-azaniumyl-3-methoxy-3-oxopropyl]disulfanyl]-1-methoxy-1-oxopropan-2-yl]azanium dichloride.
| Compound Name | [(2R)-3-[[(2R)-2-azaniumyl-3-methoxy-3-oxopropyl]disulfanyl]-1-methoxy-1-oxopropan-2-yl]azanium dichloride |
|---|---|
| PubChem CID | 11089122 |
| Molecular Formula | C8H18Cl2N2O4S2 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | [(2R)-3-[[(2R)-2-azaniumyl-3-methoxy-3-oxopropyl]disulfanyl]-1-methoxy-1-oxopropan-2-yl]azanium dichloride |
| SMILES | COC(=O)[C@@H]([NH3+])CSSC[C@H]([NH3+])C(=O)OC.[Cl-].[Cl-] |
| InChI | InChI=1S/C8H16N2O4S2.2ClH/c1-13-7(11)5(9)3-15-16-4-6(10)8(12)14-2;;/h5-6H,3-4,9-10H2,1-2H3;2*1H/t5-,6-;;/m0../s1 |
| InChIKey | QKWGUPFPCRKKMQ-USPAICOZSA-N |
| XLogP | -8.06 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | -8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|