C9H18ClNO4 — CID 10922646
[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]azanium chloride (PubChem CID 10922646) has the molecular formula C9H18ClNO4 and a molecular weight of 239.70 g/mol. Its IUPAC name is [(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]azanium chloride.
| Compound Name | [(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 10922646 |
| Molecular Formula | C9H18ClNO4 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | [(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]azanium chloride |
| SMILES | CCOC(=O)CC[C@H]([NH3+])C(=O)OCC.[Cl-] |
| InChI | InChI=1S/C9H17NO4.ClH/c1-3-13-8(11)6-5-7(10)9(12)14-4-2;/h7H,3-6,10H2,1-2H3;1H/t7-;/m0./s1 |
| InChIKey | WSEQLMQNPBNMSL-FJXQXJEOSA-N |
| XLogP | -3.49 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |