About diethyl 4-iodoheptanedioate
diethyl 4-iodoheptanedioate (PubChem CID 102577942) has the molecular formula C11H19IO4
and a molecular weight of 342.17 g/mol. Its IUPAC name is diethyl 4-iodoheptanedioate.
Molecular Properties
| Compound Name | diethyl 4-iodoheptanedioate |
| PubChem CID | 102577942 |
| Molecular Formula | C11H19IO4 |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | diethyl 4-iodoheptanedioate |
| SMILES | CCOC(=O)CCC(I)CCC(=O)OCC |
| InChI | InChI=1S/C11H19IO4/c1-3-15-10(13)7-5-9(12)6-8-11(14)16-4-2/h9H,3-8H2,1-2H3 |
| InChIKey | MJWPFIWAVVTAPF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diethyl 4-iodoheptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-iodoheptanedioate?
The IUPAC name of diethyl 4-iodoheptanedioate (CID 102577942) is diethyl 4-iodoheptanedioate.
What is the SMILES notation for diethyl 4-iodoheptanedioate?
The canonical SMILES for diethyl 4-iodoheptanedioate is CCOC(=O)CCC(I)CCC(=O)OCC.
What is the InChIKey of diethyl 4-iodoheptanedioate?
The InChIKey is MJWPFIWAVVTAPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19IO4/c1-3-15-10(13)7-5-9(12)6-8-11(14)16-4-2/h9H,3-8H2,1-2H3.
What are the key properties of diethyl 4-iodoheptanedioate?
diethyl 4-iodoheptanedioate has a molecular weight of 342.17 g/mol, XLogP of 2.48, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-iodoheptanedioate is sourced from PubChem (CID 102577942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).