About ethyl 4-ethyl-7-iodoheptanoate
ethyl 4-ethyl-7-iodoheptanoate (PubChem CID 54154836) has the molecular formula C11H21IO2
and a molecular weight of 312.19 g/mol. Its IUPAC name is ethyl 4-ethyl-7-iodoheptanoate.
Molecular Properties
| Compound Name | ethyl 4-ethyl-7-iodoheptanoate |
| PubChem CID | 54154836 |
| Molecular Formula | C11H21IO2 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | ethyl 4-ethyl-7-iodoheptanoate |
| SMILES | CCOC(=O)CCC(CC)CCCI |
| InChI | InChI=1S/C11H21IO2/c1-3-10(6-5-9-12)7-8-11(13)14-4-2/h10H,3-9H2,1-2H3 |
| InChIKey | OKHLQJZLQUOALK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-ethyl-7-iodoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-ethyl-7-iodoheptanoate?
The IUPAC name of ethyl 4-ethyl-7-iodoheptanoate (CID 54154836) is ethyl 4-ethyl-7-iodoheptanoate.
What is the SMILES notation for ethyl 4-ethyl-7-iodoheptanoate?
The canonical SMILES for ethyl 4-ethyl-7-iodoheptanoate is CCOC(=O)CCC(CC)CCCI.
What is the InChIKey of ethyl 4-ethyl-7-iodoheptanoate?
The InChIKey is OKHLQJZLQUOALK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21IO2/c1-3-10(6-5-9-12)7-8-11(13)14-4-2/h10H,3-9H2,1-2H3.
What are the key properties of ethyl 4-ethyl-7-iodoheptanoate?
ethyl 4-ethyl-7-iodoheptanoate has a molecular weight of 312.19 g/mol, XLogP of 3.57, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-ethyl-7-iodoheptanoate is sourced from PubChem (CID 54154836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).