C9H18ClN5O3 — CID 90010411
[5-(3-azidopropylamino)-1-methoxy-1,5-dioxopentan-2-yl]azanium chloride (PubChem CID 90010411) has the molecular formula C9H18ClN5O3 and a molecular weight of 279.73 g/mol. Its IUPAC name is [5-(3-azidopropylamino)-1-methoxy-1,5-dioxopentan-2-yl]azanium chloride.
| Compound Name | [5-(3-azidopropylamino)-1-methoxy-1,5-dioxopentan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 90010411 |
| Molecular Formula | C9H18ClN5O3 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | [5-(3-azidopropylamino)-1-methoxy-1,5-dioxopentan-2-yl]azanium chloride |
| SMILES | COC(=O)C([NH3+])CCC(=O)NCCCN=[N+]=[N-].[Cl-] |
| InChI | InChI=1S/C9H17N5O3.ClH/c1-17-9(16)7(10)3-4-8(15)12-5-2-6-13-14-11;/h7H,2-6,10H2,1H3,(H,12,15);1H |
| InChIKey | BAALDBCUCRMZGM-UHFFFAOYSA-N |
| XLogP | -3.63 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|