C19H39N3O3 — CID 126551698
ethyl 5-(aminomethylamino)-2-(undecanoylamino)pentanoate (PubChem CID 126551698) has the molecular formula C19H39N3O3 and a molecular weight of 357.54 g/mol. Its IUPAC name is ethyl 5-(aminomethylamino)-2-(undecanoylamino)pentanoate.
| Compound Name | ethyl 5-(aminomethylamino)-2-(undecanoylamino)pentanoate |
|---|---|
| PubChem CID | 126551698 |
| Molecular Formula | C19H39N3O3 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | ethyl 5-(aminomethylamino)-2-(undecanoylamino)pentanoate |
| SMILES | CCCCCCCCCCC(=O)NC(CCCNCN)C(=O)OCC |
| InChI | InChI=1S/C19H39N3O3/c1-3-5-6-7-8-9-10-11-14-18(23)22-17(19(24)25-4-2)13-12-15-21-16-20/h17,21H,3-16,20H2,1-2H3,(H,22,23) |
| InChIKey | LORUXLDJWKCZBA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|