C45H81NO4 — CID 147729582
[(9Z,12Z)-octadeca-9,12-dienyl] 9-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]nonanoate (PubChem CID 147729582) has the molecular formula C45H81NO4 and a molecular weight of 700.15 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] 9-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]nonanoate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] 9-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]nonanoate |
|---|---|
| PubChem CID | 147729582 |
| Molecular Formula | C45H81NO4 |
| Molecular Weight | 700.15 g/mol |
| Exact Mass | 699.62 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] 9-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]nonanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)C(CCCCCCCO)NC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C45H81NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34-38-42-50-45(49)43(39-35-31-30-33-37-41-47)46-44(48)40-36-32-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,43,47H,3-10,15-16,21-42H2,1-2H3,(H,46,48)/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | GYDRBICNGLCRJR-MAZCIEHSSA-N |
| XLogP | 12.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.15 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|