C44H80N3O4+ — CID 121434498
trimethyl-[2-[[(2S)-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-3-oxopropyl]amino]-2-oxoethyl]azanium (PubChem CID 121434498) has the molecular formula C44H80N3O4+ and a molecular weight of 715.14 g/mol. Its IUPAC name is trimethyl-[2-[[(2S)-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-3-oxopropyl]amino]-2-oxoethyl]azanium.
| Compound Name | trimethyl-[2-[[(2S)-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-3-oxopropyl]amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 121434498 |
| Molecular Formula | C44H80N3O4+ |
| Molecular Weight | 715.14 g/mol |
| Exact Mass | 714.61 |
| IUPAC Name | trimethyl-[2-[[(2S)-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-3-oxopropyl]amino]-2-oxoethyl]azanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)[C@H](CNC(=O)C[N+](C)(C)C)NC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C44H79N3O4/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-51-44(50)41(39-45-43(49)40-47(3,4)5)46-42(48)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,41H,6-13,18-19,24-40H2,1-5H3,(H-,45,46,48,49)/p+1/b16-14-,17-15-,22-20-,23-21-/t41-/m0/s1 |
| InChIKey | FISDRRLETLKBIA-VHGBNYRASA-O |
| XLogP | 10.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.14 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|