C21H44N2O5P+ — CID 89021574
[(2S)-3-amino-2-[[(Z)-octadec-9-enoyl]amino]propoxy]-trihydroxyphosphanium (PubChem CID 89021574) has the molecular formula C21H44N2O5P+ and a molecular weight of 435.57 g/mol. Its IUPAC name is [(2S)-3-amino-2-[[(Z)-octadec-9-enoyl]amino]propoxy]-trihydroxyphosphanium.
| Compound Name | [(2S)-3-amino-2-[[(Z)-octadec-9-enoyl]amino]propoxy]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 89021574 |
| Molecular Formula | C21H44N2O5P+ |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | [(2S)-3-amino-2-[[(Z)-octadec-9-enoyl]amino]propoxy]-trihydroxyphosphanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CN)CO[P+](O)(O)O |
| InChI | InChI=1S/C21H43N2O5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)23-20(18-22)19-28-29(25,26)27/h9-10,20,25-27H,2-8,11-19,22H2,1H3/p+1/b10-9-/t20-/m0/s1 |
| InChIKey | BOKHAKRWZPJQJN-QJRAZLAKSA-O |
| XLogP | 4.14 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|