C27H46ClNO5P+ — CID 70841417
[(2S)-3-(4-chlorophenyl)-2-[[(Z)-octadec-9-enoyl]amino]propoxy]-trihydroxyphosphanium (PubChem CID 70841417) has the molecular formula C27H46ClNO5P+ and a molecular weight of 531.09 g/mol. Its IUPAC name is [(2S)-3-(4-chlorophenyl)-2-[[(Z)-octadec-9-enoyl]amino]propoxy]-trihydroxyphosphanium.
| Compound Name | [(2S)-3-(4-chlorophenyl)-2-[[(Z)-octadec-9-enoyl]amino]propoxy]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 70841417 |
| Molecular Formula | C27H46ClNO5P+ |
| Molecular Weight | 531.09 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | [(2S)-3-(4-chlorophenyl)-2-[[(Z)-octadec-9-enoyl]amino]propoxy]-trihydroxyphosphanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](CO[P+](O)(O)O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H45ClNO5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-27(30)29-26(23-34-35(31,32)33)22-24-18-20-25(28)21-19-24/h9-10,18-21,26,31-33H,2-8,11-17,22-23H2,1H3/p+1/b10-9-/t26-/m0/s1 |
| InChIKey | DLSBINMJSDLGAO-IMHHWWNFSA-O |
| XLogP | 7.08 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.09 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|