C32H48NO4P — CID 11376163
[(2R)-2-[[(Z)-heptadec-8-enoyl]amino]-3-(4-phenylphenyl)propyl]phosphonic acid (PubChem CID 11376163) has the molecular formula C32H48NO4P and a molecular weight of 541.71 g/mol. Its IUPAC name is [(2R)-2-[[(Z)-heptadec-8-enoyl]amino]-3-(4-phenylphenyl)propyl]phosphonic acid.
| Compound Name | [(2R)-2-[[(Z)-heptadec-8-enoyl]amino]-3-(4-phenylphenyl)propyl]phosphonic acid |
|---|---|
| PubChem CID | 11376163 |
| Molecular Formula | C32H48NO4P |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | [(2R)-2-[[(Z)-heptadec-8-enoyl]amino]-3-(4-phenylphenyl)propyl]phosphonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCC(=O)N[C@H](Cc1ccc(-c2ccccc2)cc1)CP(=O)(O)O |
| InChI | InChI=1S/C32H48NO4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-32(34)33-31(27-38(35,36)37)26-28-22-24-30(25-23-28)29-19-16-15-17-20-29/h9-10,15-17,19-20,22-25,31H,2-8,11-14,18,21,26-27H2,1H3,(H,33,34)(H2,35,36,37)/b10-9-/t31-/m1/s1 |
| InChIKey | ILDWVYINAKKTSC-HWNQJZBBSA-N |
| XLogP | 8.21 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|