C33H47NO — CID 6436044
(9Z,12Z)-N-[(1S)-2-(4-methylphenyl)-1-phenylethyl]octadeca-9,12-dienamide (PubChem CID 6436044) has the molecular formula C33H47NO and a molecular weight of 473.75 g/mol. Its IUPAC name is (9Z,12Z)-N-[(1S)-2-(4-methylphenyl)-1-phenylethyl]octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-[(1S)-2-(4-methylphenyl)-1-phenylethyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 6436044 |
| Molecular Formula | C33H47NO |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 473.37 |
| IUPAC Name | (9Z,12Z)-N-[(1S)-2-(4-methylphenyl)-1-phenylethyl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N[C@@H](Cc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H47NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-33(35)34-32(31-21-18-17-19-22-31)28-30-26-24-29(2)25-27-30/h7-8,10-11,17-19,21-22,24-27,32H,3-6,9,12-16,20,23,28H2,1-2H3,(H,34,35)/b8-7-,11-10-/t32-/m0/s1 |
| InChIKey | GSPPFJJUCULBDC-FOCYRBLYSA-N |
| XLogP | 9.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|