C30H47NOS — CID 130246328
3-[decyl(dimethyl)-λ4-sulfanyl]-N-[2-(4-methylphenyl)-1-phenylethyl]propanamide (PubChem CID 130246328) has the molecular formula C30H47NOS and a molecular weight of 469.78 g/mol. Its IUPAC name is 3-[decyl(dimethyl)-λ4-sulfanyl]-N-[2-(4-methylphenyl)-1-phenylethyl]propanamide.
| Compound Name | 3-[decyl(dimethyl)-λ4-sulfanyl]-N-[2-(4-methylphenyl)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 130246328 |
| Molecular Formula | C30H47NOS |
| Molecular Weight | 469.78 g/mol |
| Exact Mass | 469.34 |
| IUPAC Name | 3-[decyl(dimethyl)-λ4-sulfanyl]-N-[2-(4-methylphenyl)-1-phenylethyl]propanamide |
| SMILES | CCCCCCCCCCS(C)(C)CCC(=O)NC(Cc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H47NOS/c1-5-6-7-8-9-10-11-15-23-33(3,4)24-22-30(32)31-29(28-16-13-12-14-17-28)25-27-20-18-26(2)19-21-27/h12-14,16-21,29H,5-11,15,22-25H2,1-4H3,(H,31,32) |
| InChIKey | DSZHRRKOBTXKFO-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.78 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|