C28H41NOSi — CID 54416603
3-(1-butyl-4-methylsilinan-1-yl)-N-[2-(4-methylphenyl)-1-phenylethyl]propanamide (PubChem CID 54416603) has the molecular formula C28H41NOSi and a molecular weight of 435.73 g/mol. Its IUPAC name is 3-(1-butyl-4-methylsilinan-1-yl)-N-[2-(4-methylphenyl)-1-phenylethyl]propanamide.
| Compound Name | 3-(1-butyl-4-methylsilinan-1-yl)-N-[2-(4-methylphenyl)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 54416603 |
| Molecular Formula | C28H41NOSi |
| Molecular Weight | 435.73 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 3-(1-butyl-4-methylsilinan-1-yl)-N-[2-(4-methylphenyl)-1-phenylethyl]propanamide |
| SMILES | CCCC[Si]1(CCC(=O)NC(Cc2ccc(C)cc2)c2ccccc2)CCC(C)CC1 |
| InChI | InChI=1S/C28H41NOSi/c1-4-5-18-31(19-15-24(3)16-20-31)21-17-28(30)29-27(26-9-7-6-8-10-26)22-25-13-11-23(2)12-14-25/h6-14,24,27H,4-5,15-22H2,1-3H3,(H,29,30) |
| InChIKey | VXWWNTXOUHGQCD-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.73 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|