C19H23NOS — CID 94027994
3-(4-methylphenyl)sulfanyl-N-[(1R)-1-phenylpropyl]propanamide (PubChem CID 94027994) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfanyl-N-[(1R)-1-phenylpropyl]propanamide.
| Compound Name | 3-(4-methylphenyl)sulfanyl-N-[(1R)-1-phenylpropyl]propanamide |
|---|---|
| PubChem CID | 94027994 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-(4-methylphenyl)sulfanyl-N-[(1R)-1-phenylpropyl]propanamide |
| SMILES | CC[C@@H](NC(=O)CCSc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NOS/c1-3-18(16-7-5-4-6-8-16)20-19(21)13-14-22-17-11-9-15(2)10-12-17/h4-12,18H,3,13-14H2,1-2H3,(H,20,21)/t18-/m1/s1 |
| InChIKey | QXHKLSRGAYJVHB-GOSISDBHSA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |