C19H24FN2OS+ — CID 8937610
[(2R)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-2-phenylethyl]-dimethylazanium (PubChem CID 8937610) has the molecular formula C19H24FN2OS+ and a molecular weight of 347.48 g/mol. Its IUPAC name is [(2R)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-2-phenylethyl]-dimethylazanium.
| Compound Name | [(2R)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-2-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8937610 |
| Molecular Formula | C19H24FN2OS+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [(2R)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-2-phenylethyl]-dimethylazanium |
| SMILES | C[NH+](C)C[C@H](NC(=O)CCSc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H23FN2OS/c1-22(2)14-18(15-6-4-3-5-7-15)21-19(23)12-13-24-17-10-8-16(20)9-11-17/h3-11,18H,12-14H2,1-2H3,(H,21,23)/p+1/t18-/m0/s1 |
| InChIKey | BGSPZNNRKRLSFO-SFHVURJKSA-O |
| XLogP | 2.31 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |