C18H19FN2O2S — CID 95288076
(2R)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-phenylpropanamide (PubChem CID 95288076) has the molecular formula C18H19FN2O2S and a molecular weight of 346.43 g/mol. Its IUPAC name is (2R)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-phenylpropanamide.
| Compound Name | (2R)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 95288076 |
| Molecular Formula | C18H19FN2O2S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2R)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-phenylpropanamide |
| SMILES | NC(=O)[C@@H](Cc1ccccc1)NC(=O)CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN2O2S/c19-14-6-8-15(9-7-14)24-11-10-17(22)21-16(18(20)23)12-13-4-2-1-3-5-13/h1-9,16H,10-12H2,(H2,20,23)(H,21,22)/t16-/m1/s1 |
| InChIKey | WUPZPUYBLAGOTH-MRXNPFEDSA-N |
| XLogP | 2.52 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |