C17H31N2O5P — CID 91028509
ethane;[2-(octanoylamino)-2-pyridin-3-ylethyl] dihydrogen phosphate (PubChem CID 91028509) has the molecular formula C17H31N2O5P and a molecular weight of 374.42 g/mol. Its IUPAC name is ethane;[2-(octanoylamino)-2-pyridin-3-ylethyl] dihydrogen phosphate.
| Compound Name | ethane;[2-(octanoylamino)-2-pyridin-3-ylethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91028509 |
| Molecular Formula | C17H31N2O5P |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | ethane;[2-(octanoylamino)-2-pyridin-3-ylethyl] dihydrogen phosphate |
| SMILES | CC.CCCCCCCC(=O)NC(COP(=O)(O)O)c1cccnc1 |
| InChI | InChI=1S/C15H25N2O5P.C2H6/c1-2-3-4-5-6-9-15(18)17-14(12-22-23(19,20)21)13-8-7-10-16-11-13;1-2/h7-8,10-11,14H,2-6,9,12H2,1H3,(H,17,18)(H2,19,20,21);1-2H3 |
| InChIKey | OEJVMEJKIKDWMT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|