C17H29N2O4PS — CID 18339844
[2-methyl-1-(octanethioylamino)-1-pyridin-3-ylpropan-2-yl] dihydrogen phosphate (PubChem CID 18339844) has the molecular formula C17H29N2O4PS and a molecular weight of 388.47 g/mol. Its IUPAC name is [2-methyl-1-(octanethioylamino)-1-pyridin-3-ylpropan-2-yl] dihydrogen phosphate.
| Compound Name | [2-methyl-1-(octanethioylamino)-1-pyridin-3-ylpropan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18339844 |
| Molecular Formula | C17H29N2O4PS |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [2-methyl-1-(octanethioylamino)-1-pyridin-3-ylpropan-2-yl] dihydrogen phosphate |
| SMILES | CCCCCCCC(=S)NC(c1cccnc1)C(C)(C)OP(=O)(O)O |
| InChI | InChI=1S/C17H29N2O4PS/c1-4-5-6-7-8-11-15(25)19-16(14-10-9-12-18-13-14)17(2,3)23-24(20,21)22/h9-10,12-13,16H,4-8,11H2,1-3H3,(H,19,25)(H2,20,21,22) |
| InChIKey | ZRHWWBIGLGVUQT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|