C17H33N2O6PS — CID 91133736
ethane;[1-(heptylsulfonylamino)-1-pyridin-3-ylpropan-2-yl] dihydrogen phosphate (PubChem CID 91133736) has the molecular formula C17H33N2O6PS and a molecular weight of 424.50 g/mol. Its IUPAC name is ethane;[1-(heptylsulfonylamino)-1-pyridin-3-ylpropan-2-yl] dihydrogen phosphate.
| Compound Name | ethane;[1-(heptylsulfonylamino)-1-pyridin-3-ylpropan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91133736 |
| Molecular Formula | C17H33N2O6PS |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | ethane;[1-(heptylsulfonylamino)-1-pyridin-3-ylpropan-2-yl] dihydrogen phosphate |
| SMILES | CC.CCCCCCCS(=O)(=O)NC(c1cccnc1)C(C)OP(=O)(O)O |
| InChI | InChI=1S/C15H27N2O6PS.C2H6/c1-3-4-5-6-7-11-25(21,22)17-15(13(2)23-24(18,19)20)14-9-8-10-16-12-14;1-2/h8-10,12-13,15,17H,3-7,11H2,1-2H3,(H2,18,19,20);1-2H3 |
| InChIKey | GDEOGMLXMYBTQR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|