C19H34NO5P — CID 91392818
ethane;[1-(octanoylamino)-1-phenylpropan-2-yl] dihydrogen phosphate (PubChem CID 91392818) has the molecular formula C19H34NO5P and a molecular weight of 387.46 g/mol. Its IUPAC name is ethane;[1-(octanoylamino)-1-phenylpropan-2-yl] dihydrogen phosphate.
| Compound Name | ethane;[1-(octanoylamino)-1-phenylpropan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91392818 |
| Molecular Formula | C19H34NO5P |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | ethane;[1-(octanoylamino)-1-phenylpropan-2-yl] dihydrogen phosphate |
| SMILES | CC.CCCCCCCC(=O)NC(c1ccccc1)C(C)OP(=O)(O)O |
| InChI | InChI=1S/C17H28NO5P.C2H6/c1-3-4-5-6-10-13-16(19)18-17(14(2)23-24(20,21)22)15-11-8-7-9-12-15;1-2/h7-9,11-12,14,17H,3-6,10,13H2,1-2H3,(H,18,19)(H2,20,21,22);1-2H3 |
| InChIKey | NRIOAESBFNFZLU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|