C17H26NNa2O6P — CID 59924163
disodium;[(1R,2R)-3-hydroxy-1-(octanoylamino)-1-phenylpropan-2-yl] phosphate (PubChem CID 59924163) has the molecular formula C17H26NNa2O6P and a molecular weight of 417.35 g/mol. Its IUPAC name is disodium;[(1R,2R)-3-hydroxy-1-(octanoylamino)-1-phenylpropan-2-yl] phosphate.
| Compound Name | disodium;[(1R,2R)-3-hydroxy-1-(octanoylamino)-1-phenylpropan-2-yl] phosphate |
|---|---|
| PubChem CID | 59924163 |
| Molecular Formula | C17H26NNa2O6P |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | disodium;[(1R,2R)-3-hydroxy-1-(octanoylamino)-1-phenylpropan-2-yl] phosphate |
| SMILES | CCCCCCCC(=O)N[C@H](c1ccccc1)[C@H](CO)OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C17H28NO6P.2Na/c1-2-3-4-5-9-12-16(20)18-17(14-10-7-6-8-11-14)15(13-19)24-25(21,22)23;;/h6-8,10-11,15,17,19H,2-5,9,12-13H2,1H3,(H,18,20)(H2,21,22,23);;/q;2*+1/p-2/t15-,17+;;/m0../s1 |
| InChIKey | KROGFWUFGQXOCY-WUGUAYAESA-L |
| XLogP | -4.58 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|