C20H30NO6PS — CID 18339871
[1-(heptylsulfonylamino)-1-naphthalen-1-ylpropan-2-yl] dihydrogen phosphate (PubChem CID 18339871) has the molecular formula C20H30NO6PS and a molecular weight of 443.50 g/mol. Its IUPAC name is [1-(heptylsulfonylamino)-1-naphthalen-1-ylpropan-2-yl] dihydrogen phosphate.
| Compound Name | [1-(heptylsulfonylamino)-1-naphthalen-1-ylpropan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18339871 |
| Molecular Formula | C20H30NO6PS |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [1-(heptylsulfonylamino)-1-naphthalen-1-ylpropan-2-yl] dihydrogen phosphate |
| SMILES | CCCCCCCS(=O)(=O)NC(c1cccc2ccccc12)C(C)OP(=O)(O)O |
| InChI | InChI=1S/C20H30NO6PS/c1-3-4-5-6-9-15-29(25,26)21-20(16(2)27-28(22,23)24)19-14-10-12-17-11-7-8-13-18(17)19/h7-8,10-14,16,20-21H,3-6,9,15H2,1-2H3,(H2,22,23,24) |
| InChIKey | NPRUTVLSAGXERV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|