C20H28NO4PS — CID 18339860
[2-naphthalen-1-yl-2-(octanethioylamino)ethyl] dihydrogen phosphate (PubChem CID 18339860) has the molecular formula C20H28NO4PS and a molecular weight of 409.49 g/mol. Its IUPAC name is [2-naphthalen-1-yl-2-(octanethioylamino)ethyl] dihydrogen phosphate.
| Compound Name | [2-naphthalen-1-yl-2-(octanethioylamino)ethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18339860 |
| Molecular Formula | C20H28NO4PS |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-naphthalen-1-yl-2-(octanethioylamino)ethyl] dihydrogen phosphate |
| SMILES | CCCCCCCC(=S)NC(COP(=O)(O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H28NO4PS/c1-2-3-4-5-6-14-20(27)21-19(15-25-26(22,23)24)18-13-9-11-16-10-7-8-12-17(16)18/h7-13,19H,2-6,14-15H2,1H3,(H,21,27)(H2,22,23,24) |
| InChIKey | CPPPLSHZWOHOAA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|