C21H32NO6PS — CID 18339867
[1-(heptylsulfonylamino)-2-methyl-1-naphthalen-1-ylpropan-2-yl] dihydrogen phosphate (PubChem CID 18339867) has the molecular formula C21H32NO6PS and a molecular weight of 457.53 g/mol. Its IUPAC name is [1-(heptylsulfonylamino)-2-methyl-1-naphthalen-1-ylpropan-2-yl] dihydrogen phosphate.
| Compound Name | [1-(heptylsulfonylamino)-2-methyl-1-naphthalen-1-ylpropan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18339867 |
| Molecular Formula | C21H32NO6PS |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | [1-(heptylsulfonylamino)-2-methyl-1-naphthalen-1-ylpropan-2-yl] dihydrogen phosphate |
| SMILES | CCCCCCCS(=O)(=O)NC(c1cccc2ccccc12)C(C)(C)OP(=O)(O)O |
| InChI | InChI=1S/C21H32NO6PS/c1-4-5-6-7-10-16-30(26,27)22-20(21(2,3)28-29(23,24)25)19-15-11-13-17-12-8-9-14-18(17)19/h8-9,11-15,20,22H,4-7,10,16H2,1-3H3,(H2,23,24,25) |
| InChIKey | MIDSSQDWAWEAFW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|