C23H38NO6PS — CID 90778296
ethane;[1-(heptylsulfonylamino)-2-methyl-1-naphthalen-2-ylpropan-2-yl] dihydrogen phosphate (PubChem CID 90778296) has the molecular formula C23H38NO6PS and a molecular weight of 487.60 g/mol. Its IUPAC name is ethane;[1-(heptylsulfonylamino)-2-methyl-1-naphthalen-2-ylpropan-2-yl] dihydrogen phosphate.
| Compound Name | ethane;[1-(heptylsulfonylamino)-2-methyl-1-naphthalen-2-ylpropan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90778296 |
| Molecular Formula | C23H38NO6PS |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | ethane;[1-(heptylsulfonylamino)-2-methyl-1-naphthalen-2-ylpropan-2-yl] dihydrogen phosphate |
| SMILES | CC.CCCCCCCS(=O)(=O)NC(c1ccc2ccccc2c1)C(C)(C)OP(=O)(O)O |
| InChI | InChI=1S/C21H32NO6PS.C2H6/c1-4-5-6-7-10-15-30(26,27)22-20(21(2,3)28-29(23,24)25)19-14-13-17-11-8-9-12-18(17)16-19;1-2/h8-9,11-14,16,20,22H,4-7,10,15H2,1-3H3,(H2,23,24,25);1-2H3 |
| InChIKey | MSJGYMUVLRYLTK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|