C23H42NO8PS — CID 67677785
[4-(hexylsulfonylamino)-1,3-dihydroxy-2-phenylmethoxydecyl]phosphonic acid (PubChem CID 67677785) has the molecular formula C23H42NO8PS and a molecular weight of 523.63 g/mol. Its IUPAC name is [4-(hexylsulfonylamino)-1,3-dihydroxy-2-phenylmethoxydecyl]phosphonic acid.
| Compound Name | [4-(hexylsulfonylamino)-1,3-dihydroxy-2-phenylmethoxydecyl]phosphonic acid |
|---|---|
| PubChem CID | 67677785 |
| Molecular Formula | C23H42NO8PS |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | [4-(hexylsulfonylamino)-1,3-dihydroxy-2-phenylmethoxydecyl]phosphonic acid |
| SMILES | CCCCCCC(NS(=O)(=O)CCCCCC)C(O)C(OCc1ccccc1)C(O)P(=O)(O)O |
| InChI | InChI=1S/C23H42NO8PS/c1-3-5-7-12-16-20(24-34(30,31)17-13-8-6-4-2)21(25)22(23(26)33(27,28)29)32-18-19-14-10-9-11-15-19/h9-11,14-15,20-26H,3-8,12-13,16-18H2,1-2H3,(H2,27,28,29) |
| InChIKey | DUAQBUSRPHNWKD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 153.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|