C26H40NO7PS — CID 67676733
CID 67676733 (PubChem CID 67676733) has the molecular formula C26H40NO7PS and a molecular weight of 541.65 g/mol.
| Compound Name | CID 67676733 |
|---|---|
| PubChem CID | 67676733 |
| Molecular Formula | C26H40NO7PS |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | — |
| SMILES | CCCCCCC(CO)NS(=O)(=O)CCCc1ccccc1.O=P(=O)C(O)COCc1ccccc1 |
| InChI | InChI=1S/C17H29NO3S.C9H11O4P/c1-2-3-4-8-13-17(15-19)18-22(20,21)14-9-12-16-10-6-5-7-11-16;10-9(14(11)12)7-13-6-8-4-2-1-3-5-8/h5-7,10-11,17-19H,2-4,8-9,12-15H2,1H3;1-5,9-10H,6-7H2 |
| InChIKey | MIKGKQSRYQLNLK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|